About 2-[4-(1-ethylpyridin-1-ium-4-yl)phenyl]-1,3-benzothiazole bromide
2-[4-(1-ethylpyridin-1-ium-4-yl)phenyl]-1,3-benzothiazole bromide (PubChem CID 164614172) has the molecular formula C20H17BrN2S
and a molecular weight of 397.34 g/mol. Its IUPAC name is 2-[4-(1-ethylpyridin-1-ium-4-yl)phenyl]-1,3-benzothiazole bromide.
Molecular Properties
| Compound Name | 2-[4-(1-ethylpyridin-1-ium-4-yl)phenyl]-1,3-benzothiazole bromide |
| PubChem CID | 164614172 |
| Molecular Formula | C20H17BrN2S |
| Molecular Weight | 397.34 g/mol |
| Exact Mass | 396.03 |
| IUPAC Name | 2-[4-(1-ethylpyridin-1-ium-4-yl)phenyl]-1,3-benzothiazole bromide |
| SMILES | CC[n+]1ccc(-c2ccc(-c3nc4ccccc4s3)cc2)cc1.[Br-] |
| InChI | InChI=1S/C20H17N2S.BrH/c1-2-22-13-11-16(12-14-22)15-7-9-17(10-8-15)20-21-18-5-3-4-6-19(18)23-20;/h3-14H,2H2,1H3;1H/q+1;/p-1 |
| InChIKey | CEQZNPINUVXKII-UHFFFAOYSA-M |
| XLogP | 1.94 |
| TPSA | 16.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 397.34 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 2-[4-(1-ethylpyridin-1-ium-4-yl)phenyl]-1,3-benzothiazole bromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-(1-ethylpyridin-1-ium-4-yl)phenyl]-1,3-benzothiazole bromide?
The IUPAC name of 2-[4-(1-ethylpyridin-1-ium-4-yl)phenyl]-1,3-benzothiazole bromide (CID 164614172) is 2-[4-(1-ethylpyridin-1-ium-4-yl)phenyl]-1,3-benzothiazole bromide.
What is the SMILES notation for 2-[4-(1-ethylpyridin-1-ium-4-yl)phenyl]-1,3-benzothiazole bromide?
The canonical SMILES for 2-[4-(1-ethylpyridin-1-ium-4-yl)phenyl]-1,3-benzothiazole bromide is CC[n+]1ccc(-c2ccc(-c3nc4ccccc4s3)cc2)cc1.[Br-].
What is the InChIKey of 2-[4-(1-ethylpyridin-1-ium-4-yl)phenyl]-1,3-benzothiazole bromide?
The InChIKey is CEQZNPINUVXKII-UHFFFAOYSA-M. The full InChI is InChI=1S/C20H17N2S.BrH/c1-2-22-13-11-16(12-14-22)15-7-9-17(10-8-15)20-21-18-5-3-4-6-19(18)23-20;/h3-14H,2H2,1H3;1H/q+1;/p-1.
What are the key properties of 2-[4-(1-ethylpyridin-1-ium-4-yl)phenyl]-1,3-benzothiazole bromide?
2-[4-(1-ethylpyridin-1-ium-4-yl)phenyl]-1,3-benzothiazole bromide has a molecular weight of 397.34 g/mol, XLogP of 1.94, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-(1-ethylpyridin-1-ium-4-yl)phenyl]-1,3-benzothiazole bromide is sourced from PubChem (CID 164614172), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).