C33H24F3N5O5S — CID 164616341
N'-hydroxy-3-[6-[3-[(Z)-N'-hydroxycarbamimidoyl]phenyl]-9-[3-(trifluoromethoxy)phenyl]sulfonylcarbazol-3-yl]benzenecarboximidamide (PubChem CID 164616341) has the molecular formula C33H24F3N5O5S and a molecular weight of 659.65 g/mol. Its IUPAC name is N'-hydroxy-3-[6-[3-[(Z)-N'-hydroxycarbamimidoyl]phenyl]-9-[3-(trifluoromethoxy)phenyl]sulfonylcarbazol-3-yl]benzenecarboximidamide.
| Compound Name | N'-hydroxy-3-[6-[3-[(Z)-N'-hydroxycarbamimidoyl]phenyl]-9-[3-(trifluoromethoxy)phenyl]sulfonylcarbazol-3-yl]benzenecarboximidamide |
|---|---|
| PubChem CID | 164616341 |
| Molecular Formula | C33H24F3N5O5S |
| Molecular Weight | 659.65 g/mol |
| Exact Mass | 659.15 |
| IUPAC Name | N'-hydroxy-3-[6-[3-[(Z)-N'-hydroxycarbamimidoyl]phenyl]-9-[3-(trifluoromethoxy)phenyl]sulfonylcarbazol-3-yl]benzenecarboximidamide |
| SMILES | N/C(=N\O)c1cccc(-c2ccc3c(c2)c2cc(-c4cccc(/C(N)=N/O)c4)ccc2n3S(=O)(=O)c2cccc(OC(F)(F)F)c2)c1 |
| InChI | InChI=1S/C33H24F3N5O5S/c34-33(35,36)46-25-8-3-9-26(18-25)47(44,45)41-29-12-10-21(19-4-1-6-23(14-19)31(37)39-42)16-27(29)28-17-22(11-13-30(28)41)20-5-2-7-24(15-20)32(38)40-43/h1-18,42-43H,(H2,37,39)(H2,38,40) |
| InChIKey | YOGRMCYBWAUTAP-UHFFFAOYSA-N |
| XLogP | 6.45 |
| TPSA | 165.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 659.65 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|