C21H18O2 — CID 164616887
(2R,3R)-5-methoxy-2,3-diphenyl-2,3-dihydro-1-benzofuran (PubChem CID 164616887) has the molecular formula C21H18O2 and a molecular weight of 302.37 g/mol. Its IUPAC name is (2R,3R)-5-methoxy-2,3-diphenyl-2,3-dihydro-1-benzofuran.
| Compound Name | (2R,3R)-5-methoxy-2,3-diphenyl-2,3-dihydro-1-benzofuran |
|---|---|
| PubChem CID | 164616887 |
| Molecular Formula | C21H18O2 |
| Molecular Weight | 302.37 g/mol |
| Exact Mass | 302.13 |
| IUPAC Name | (2R,3R)-5-methoxy-2,3-diphenyl-2,3-dihydro-1-benzofuran |
| SMILES | COc1ccc2c(c1)[C@@H](c1ccccc1)[C@H](c1ccccc1)O2 |
| InChI | InChI=1S/C21H18O2/c1-22-17-12-13-19-18(14-17)20(15-8-4-2-5-9-15)21(23-19)16-10-6-3-7-11-16/h2-14,20-21H,1H3/t20-,21+/m1/s1 |
| InChIKey | YLEOYEHKNXPVJA-RTWAWAEBSA-N |
| XLogP | 4.96 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.37 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |