C12H16N6O4 — CID 164620136
3-(2-methoxyethoxy)-5-[3-(2-methoxyethoxy)-1,2,4-triazin-5-yl]-1,2,4-triazine (PubChem CID 164620136) has the molecular formula C12H16N6O4 and a molecular weight of 308.30 g/mol. Its IUPAC name is 3-(2-methoxyethoxy)-5-[3-(2-methoxyethoxy)-1,2,4-triazin-5-yl]-1,2,4-triazine.
| Compound Name | 3-(2-methoxyethoxy)-5-[3-(2-methoxyethoxy)-1,2,4-triazin-5-yl]-1,2,4-triazine |
|---|---|
| PubChem CID | 164620136 |
| Molecular Formula | C12H16N6O4 |
| Molecular Weight | 308.30 g/mol |
| Exact Mass | 308.12 |
| IUPAC Name | 3-(2-methoxyethoxy)-5-[3-(2-methoxyethoxy)-1,2,4-triazin-5-yl]-1,2,4-triazine |
| SMILES | COCCOc1nncc(-c2cnnc(OCCOC)n2)n1 |
| InChI | InChI=1S/C12H16N6O4/c1-19-3-5-21-11-15-9(7-13-17-11)10-8-14-18-12(16-10)22-6-4-20-2/h7-8H,3-6H2,1-2H3 |
| InChIKey | CCXZJTUBPJBHQE-UHFFFAOYSA-N |
| XLogP | -0.23 |
| TPSA | 114.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.30 |
| LogP ≤ 5 | -0.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|