C10H12N6OS2 — CID 155565039
3-(2-methoxyethylsulfanyl)-5-(3-methylsulfanyl-1,2,4-triazin-5-yl)-1,2,4-triazine (PubChem CID 155565039) has the molecular formula C10H12N6OS2 and a molecular weight of 296.38 g/mol. Its IUPAC name is 3-(2-methoxyethylsulfanyl)-5-(3-methylsulfanyl-1,2,4-triazin-5-yl)-1,2,4-triazine.
| Compound Name | 3-(2-methoxyethylsulfanyl)-5-(3-methylsulfanyl-1,2,4-triazin-5-yl)-1,2,4-triazine |
|---|---|
| PubChem CID | 155565039 |
| Molecular Formula | C10H12N6OS2 |
| Molecular Weight | 296.38 g/mol |
| Exact Mass | 296.05 |
| IUPAC Name | 3-(2-methoxyethylsulfanyl)-5-(3-methylsulfanyl-1,2,4-triazin-5-yl)-1,2,4-triazine |
| SMILES | COCCSc1nncc(-c2cnnc(SC)n2)n1 |
| InChI | InChI=1S/C10H12N6OS2/c1-17-3-4-19-10-14-8(6-12-16-10)7-5-11-15-9(13-7)18-2/h5-6H,3-4H2,1-2H3 |
| InChIKey | XFPUKPZOFVIEMD-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 86.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.38 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|