C10H8N6S2 — CID 164626362
3-methylsulfanyl-5-(3-prop-2-ynylsulfanyl-1,2,4-triazin-5-yl)-1,2,4-triazine (PubChem CID 164626362) has the molecular formula C10H8N6S2 and a molecular weight of 276.35 g/mol. Its IUPAC name is 3-methylsulfanyl-5-(3-prop-2-ynylsulfanyl-1,2,4-triazin-5-yl)-1,2,4-triazine.
| Compound Name | 3-methylsulfanyl-5-(3-prop-2-ynylsulfanyl-1,2,4-triazin-5-yl)-1,2,4-triazine |
|---|---|
| PubChem CID | 164626362 |
| Molecular Formula | C10H8N6S2 |
| Molecular Weight | 276.35 g/mol |
| Exact Mass | 276.03 |
| IUPAC Name | 3-methylsulfanyl-5-(3-prop-2-ynylsulfanyl-1,2,4-triazin-5-yl)-1,2,4-triazine |
| SMILES | C#CCSc1nncc(-c2cnnc(SC)n2)n1 |
| InChI | InChI=1S/C10H8N6S2/c1-3-4-18-10-14-8(6-12-16-10)7-5-11-15-9(13-7)17-2/h1,5-6H,4H2,2H3 |
| InChIKey | XHDRJQSDTKXGRI-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 77.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.35 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|