C5H7N3S — CID 12503454
5-methyl-3-methylsulfanyl-1,2,4-triazine (PubChem CID 12503454) has the molecular formula C5H7N3S and a molecular weight of 141.20 g/mol. Its IUPAC name is 5-methyl-3-methylsulfanyl-1,2,4-triazine.
| Compound Name | 5-methyl-3-methylsulfanyl-1,2,4-triazine |
|---|---|
| PubChem CID | 12503454 |
| Molecular Formula | C5H7N3S |
| Molecular Weight | 141.20 g/mol |
| Exact Mass | 141.04 |
| IUPAC Name | 5-methyl-3-methylsulfanyl-1,2,4-triazine |
| SMILES | CSc1nncc(C)n1 |
| InChI | InChI=1S/C5H7N3S/c1-4-3-6-8-5(7-4)9-2/h3H,1-2H3 |
| InChIKey | XIMYORHJBOQKDO-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 141.20 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |