C12H16N6O2S2 — CID 155541037
3-[[5-[3-(3-hydroxypropylsulfanyl)-1,2,4-triazin-5-yl]-1,2,4-triazin-3-yl]sulfanyl]propan-1-ol (PubChem CID 155541037) has the molecular formula C12H16N6O2S2 and a molecular weight of 340.43 g/mol. Its IUPAC name is 3-[[5-[3-(3-hydroxypropylsulfanyl)-1,2,4-triazin-5-yl]-1,2,4-triazin-3-yl]sulfanyl]propan-1-ol.
| Compound Name | 3-[[5-[3-(3-hydroxypropylsulfanyl)-1,2,4-triazin-5-yl]-1,2,4-triazin-3-yl]sulfanyl]propan-1-ol |
|---|---|
| PubChem CID | 155541037 |
| Molecular Formula | C12H16N6O2S2 |
| Molecular Weight | 340.43 g/mol |
| Exact Mass | 340.08 |
| IUPAC Name | 3-[[5-[3-(3-hydroxypropylsulfanyl)-1,2,4-triazin-5-yl]-1,2,4-triazin-3-yl]sulfanyl]propan-1-ol |
| SMILES | OCCCSc1nncc(-c2cnnc(SCCCO)n2)n1 |
| InChI | InChI=1S/C12H16N6O2S2/c19-3-1-5-21-11-15-9(7-13-17-11)10-8-14-18-12(16-10)22-6-2-4-20/h7-8,19-20H,1-6H2 |
| InChIKey | FUGCIZWAXUIGKC-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 117.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.43 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|