C9H14N2O3S — CID 115355266
3-(4,6-dimethoxypyrimidin-2-yl)sulfanylpropan-1-ol (PubChem CID 115355266) has the molecular formula C9H14N2O3S and a molecular weight of 230.29 g/mol. Its IUPAC name is 3-(4,6-dimethoxypyrimidin-2-yl)sulfanylpropan-1-ol.
| Compound Name | 3-(4,6-dimethoxypyrimidin-2-yl)sulfanylpropan-1-ol |
|---|---|
| PubChem CID | 115355266 |
| Molecular Formula | C9H14N2O3S |
| Molecular Weight | 230.29 g/mol |
| Exact Mass | 230.07 |
| IUPAC Name | 3-(4,6-dimethoxypyrimidin-2-yl)sulfanylpropan-1-ol |
| SMILES | COc1cc(OC)nc(SCCCO)n1 |
| InChI | InChI=1S/C9H14N2O3S/c1-13-7-6-8(14-2)11-9(10-7)15-5-3-4-12/h6,12H,3-5H2,1-2H3 |
| InChIKey | ZFKZITBMBNVLPS-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 64.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.29 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|