C11H16N2O3S — CID 18966272
3-(4,6-dimethoxypyrimidin-2-yl)sulfanylpentan-2-one (PubChem CID 18966272) has the molecular formula C11H16N2O3S and a molecular weight of 256.33 g/mol. Its IUPAC name is 3-(4,6-dimethoxypyrimidin-2-yl)sulfanylpentan-2-one.
| Compound Name | 3-(4,6-dimethoxypyrimidin-2-yl)sulfanylpentan-2-one |
|---|---|
| PubChem CID | 18966272 |
| Molecular Formula | C11H16N2O3S |
| Molecular Weight | 256.33 g/mol |
| Exact Mass | 256.09 |
| IUPAC Name | 3-(4,6-dimethoxypyrimidin-2-yl)sulfanylpentan-2-one |
| SMILES | CCC(Sc1nc(OC)cc(OC)n1)C(C)=O |
| InChI | InChI=1S/C11H16N2O3S/c1-5-8(7(2)14)17-11-12-9(15-3)6-10(13-11)16-4/h6,8H,5H2,1-4H3 |
| InChIKey | HHLSDLVENWGOPA-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 61.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.33 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |