C15H21BrN2O4S — CID 154242025
2-bromo-5-(4,6-dimethoxypyrimidin-2-yl)sulfanyl-6,6-dimethylhept-2-enoic acid (PubChem CID 154242025) has the molecular formula C15H21BrN2O4S and a molecular weight of 405.31 g/mol. Its IUPAC name is 2-bromo-5-(4,6-dimethoxypyrimidin-2-yl)sulfanyl-6,6-dimethylhept-2-enoic acid.
| Compound Name | 2-bromo-5-(4,6-dimethoxypyrimidin-2-yl)sulfanyl-6,6-dimethylhept-2-enoic acid |
|---|---|
| PubChem CID | 154242025 |
| Molecular Formula | C15H21BrN2O4S |
| Molecular Weight | 405.31 g/mol |
| Exact Mass | 404.04 |
| IUPAC Name | 2-bromo-5-(4,6-dimethoxypyrimidin-2-yl)sulfanyl-6,6-dimethylhept-2-enoic acid |
| SMILES | COc1cc(OC)nc(SC(CC=C(Br)C(=O)O)C(C)(C)C)n1 |
| InChI | InChI=1S/C15H21BrN2O4S/c1-15(2,3)10(7-6-9(16)13(19)20)23-14-17-11(21-4)8-12(18-14)22-5/h6,8,10H,7H2,1-5H3,(H,19,20) |
| InChIKey | BDTVZJJPFHJYBB-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 81.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.31 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|