C15H24N2O3S — CID 18966214
2-(4,6-dimethoxypyrimidin-2-yl)sulfanyl-3,5,5-trimethylhexanal (PubChem CID 18966214) has the molecular formula C15H24N2O3S and a molecular weight of 312.44 g/mol. Its IUPAC name is 2-(4,6-dimethoxypyrimidin-2-yl)sulfanyl-3,5,5-trimethylhexanal.
| Compound Name | 2-(4,6-dimethoxypyrimidin-2-yl)sulfanyl-3,5,5-trimethylhexanal |
|---|---|
| PubChem CID | 18966214 |
| Molecular Formula | C15H24N2O3S |
| Molecular Weight | 312.44 g/mol |
| Exact Mass | 312.15 |
| IUPAC Name | 2-(4,6-dimethoxypyrimidin-2-yl)sulfanyl-3,5,5-trimethylhexanal |
| SMILES | COc1cc(OC)nc(SC(C=O)C(C)CC(C)(C)C)n1 |
| InChI | InChI=1S/C15H24N2O3S/c1-10(8-15(2,3)4)11(9-18)21-14-16-12(19-5)7-13(17-14)20-6/h7,9-11H,8H2,1-6H3 |
| InChIKey | VXVPADPHCCQMET-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 61.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.44 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|