C10H11F3N2O3S — CID 18966116
2-(4,6-dimethoxypyrimidin-2-yl)sulfanyl-4,4,4-trifluorobutanal (PubChem CID 18966116) has the molecular formula C10H11F3N2O3S and a molecular weight of 296.27 g/mol. Its IUPAC name is 2-(4,6-dimethoxypyrimidin-2-yl)sulfanyl-4,4,4-trifluorobutanal.
| Compound Name | 2-(4,6-dimethoxypyrimidin-2-yl)sulfanyl-4,4,4-trifluorobutanal |
|---|---|
| PubChem CID | 18966116 |
| Molecular Formula | C10H11F3N2O3S |
| Molecular Weight | 296.27 g/mol |
| Exact Mass | 296.04 |
| IUPAC Name | 2-(4,6-dimethoxypyrimidin-2-yl)sulfanyl-4,4,4-trifluorobutanal |
| SMILES | COc1cc(OC)nc(SC(C=O)CC(F)(F)F)n1 |
| InChI | InChI=1S/C10H11F3N2O3S/c1-17-7-3-8(18-2)15-9(14-7)19-6(5-16)4-10(11,12)13/h3,5-6H,4H2,1-2H3 |
| InChIKey | OSJBHMWCTQBLAH-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 61.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.27 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|