C18H26N6OS — CID 164620678
1-[N'-[3-(2-amino-4-methyl-1,3-thiazol-5-yl)propyl]carbamimidoyl]-3-(1-phenylpropyl)urea (PubChem CID 164620678) has the molecular formula C18H26N6OS and a molecular weight of 374.51 g/mol. Its IUPAC name is 1-[N'-[3-(2-amino-4-methyl-1,3-thiazol-5-yl)propyl]carbamimidoyl]-3-(1-phenylpropyl)urea.
| Compound Name | 1-[N'-[3-(2-amino-4-methyl-1,3-thiazol-5-yl)propyl]carbamimidoyl]-3-(1-phenylpropyl)urea |
|---|---|
| PubChem CID | 164620678 |
| Molecular Formula | C18H26N6OS |
| Molecular Weight | 374.51 g/mol |
| Exact Mass | 374.19 |
| IUPAC Name | 1-[N'-[3-(2-amino-4-methyl-1,3-thiazol-5-yl)propyl]carbamimidoyl]-3-(1-phenylpropyl)urea |
| SMILES | CCC(NC(=O)N/C(N)=N/CCCc1sc(N)nc1C)c1ccccc1 |
| InChI | InChI=1S/C18H26N6OS/c1-3-14(13-8-5-4-6-9-13)23-18(25)24-16(19)21-11-7-10-15-12(2)22-17(20)26-15/h4-6,8-9,14H,3,7,10-11H2,1-2H3,(H2,20,22)(H4,19,21,23,24,25) |
| InChIKey | VKIMBPNGXDKNLX-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 118.42 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.51 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|