C16H15FN6O — CID 164621434
N-[[4-(2-amino-2-iminoethyl)-3-fluorophenyl]methyl]-[1,2,4]triazolo[4,3-a]pyridine-6-carboxamide (PubChem CID 164621434) has the molecular formula C16H15FN6O and a molecular weight of 326.34 g/mol. Its IUPAC name is N-[[4-(2-amino-2-iminoethyl)-3-fluorophenyl]methyl]-[1,2,4]triazolo[4,3-a]pyridine-6-carboxamide.
| Compound Name | N-[[4-(2-amino-2-iminoethyl)-3-fluorophenyl]methyl]-[1,2,4]triazolo[4,3-a]pyridine-6-carboxamide |
|---|---|
| PubChem CID | 164621434 |
| Molecular Formula | C16H15FN6O |
| Molecular Weight | 326.34 g/mol |
| Exact Mass | 326.13 |
| IUPAC Name | N-[[4-(2-amino-2-iminoethyl)-3-fluorophenyl]methyl]-[1,2,4]triazolo[4,3-a]pyridine-6-carboxamide |
| SMILES | [H]/N=C(\N)Cc1ccc(CNC(=O)c2ccc3nncn3c2)cc1F |
| InChI | InChI=1S/C16H15FN6O/c17-13-5-10(1-2-11(13)6-14(18)19)7-20-16(24)12-3-4-15-22-21-9-23(15)8-12/h1-5,8-9H,6-7H2,(H3,18,19)(H,20,24) |
| InChIKey | RTSSVFHDMOSAKC-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 109.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.34 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|