C13H13F3O4Se — CID 164622133
1-O-methyl 2-O-[3-(trifluoromethylselanyl)propyl] benzene-1,2-dicarboxylate (PubChem CID 164622133) has the molecular formula C13H13F3O4Se and a molecular weight of 369.20 g/mol. Its IUPAC name is 1-O-methyl 2-O-[3-(trifluoromethylselanyl)propyl] benzene-1,2-dicarboxylate.
| Compound Name | 1-O-methyl 2-O-[3-(trifluoromethylselanyl)propyl] benzene-1,2-dicarboxylate |
|---|---|
| PubChem CID | 164622133 |
| Molecular Formula | C13H13F3O4Se |
| Molecular Weight | 369.20 g/mol |
| Exact Mass | 369.99 |
| IUPAC Name | 1-O-methyl 2-O-[3-(trifluoromethylselanyl)propyl] benzene-1,2-dicarboxylate |
| SMILES | COC(=O)c1ccccc1C(=O)OCCC[Se]C(F)(F)F |
| InChI | InChI=1S/C13H13F3O4Se/c1-19-11(17)9-5-2-3-6-10(9)12(18)20-7-4-8-21-13(14,15)16/h2-3,5-6H,4,7-8H2,1H3 |
| InChIKey | HLFQIZUGKPGBRR-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.20 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|