C23H25Cl3N2O6 — CID 164622915
2,2,2-trichloroethyl N-[(7S)-1,2,3-trimethoxy-10-(methylamino)-9-oxo-6,7-dihydro-5H-benzo[a]heptalen-7-yl]carbamate (PubChem CID 164622915) has the molecular formula C23H25Cl3N2O6 and a molecular weight of 531.82 g/mol. Its IUPAC name is 2,2,2-trichloroethyl N-[(7S)-1,2,3-trimethoxy-10-(methylamino)-9-oxo-6,7-dihydro-5H-benzo[a]heptalen-7-yl]carbamate.
| Compound Name | 2,2,2-trichloroethyl N-[(7S)-1,2,3-trimethoxy-10-(methylamino)-9-oxo-6,7-dihydro-5H-benzo[a]heptalen-7-yl]carbamate |
|---|---|
| PubChem CID | 164622915 |
| Molecular Formula | C23H25Cl3N2O6 |
| Molecular Weight | 531.82 g/mol |
| Exact Mass | 530.08 |
| IUPAC Name | 2,2,2-trichloroethyl N-[(7S)-1,2,3-trimethoxy-10-(methylamino)-9-oxo-6,7-dihydro-5H-benzo[a]heptalen-7-yl]carbamate |
| SMILES | CNc1ccc2c(cc1=O)[C@@H](NC(=O)OCC(Cl)(Cl)Cl)CCc1cc(OC)c(OC)c(OC)c1-2 |
| InChI | InChI=1S/C23H25Cl3N2O6/c1-27-16-8-6-13-14(10-17(16)29)15(28-22(30)34-11-23(24,25)26)7-5-12-9-18(31-2)20(32-3)21(33-4)19(12)13/h6,8-10,15H,5,7,11H2,1-4H3,(H,27,29)(H,28,30)/t15-/m0/s1 |
| InChIKey | HFDLKOTUEPENME-HNNXBMFYSA-N |
| XLogP | 4.86 |
| TPSA | 95.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.82 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|