C21H26N4O4 — CID 164627107
2-[(7S)-1,2,3-trimethoxy-10-(methylamino)-9-oxo-6,7-dihydro-5H-benzo[a]heptalen-7-yl]guanidine (PubChem CID 164627107) has the molecular formula C21H26N4O4 and a molecular weight of 398.46 g/mol. Its IUPAC name is 2-[(7S)-1,2,3-trimethoxy-10-(methylamino)-9-oxo-6,7-dihydro-5H-benzo[a]heptalen-7-yl]guanidine.
| Compound Name | 2-[(7S)-1,2,3-trimethoxy-10-(methylamino)-9-oxo-6,7-dihydro-5H-benzo[a]heptalen-7-yl]guanidine |
|---|---|
| PubChem CID | 164627107 |
| Molecular Formula | C21H26N4O4 |
| Molecular Weight | 398.46 g/mol |
| Exact Mass | 398.20 |
| IUPAC Name | 2-[(7S)-1,2,3-trimethoxy-10-(methylamino)-9-oxo-6,7-dihydro-5H-benzo[a]heptalen-7-yl]guanidine |
| SMILES | CNc1ccc2c(cc1=O)[C@@H](N=C(N)N)CCc1cc(OC)c(OC)c(OC)c1-2 |
| InChI | InChI=1S/C21H26N4O4/c1-24-15-8-6-12-13(10-16(15)26)14(25-21(22)23)7-5-11-9-17(27-2)19(28-3)20(29-4)18(11)12/h6,8-10,14H,5,7H2,1-4H3,(H,24,26)(H4,22,23,25)/t14-/m0/s1 |
| InChIKey | FAWQDWMAZBWCPZ-AWEZNQCLSA-N |
| XLogP | 2.04 |
| TPSA | 121.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.46 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|