C17H15ClN2O5 — CID 164624154
3-N-(5-acetyl-2-methoxyphenyl)-4-chloro-1-N-hydroxybenzene-1,3-dicarboxamide (PubChem CID 164624154) has the molecular formula C17H15ClN2O5 and a molecular weight of 362.77 g/mol. Its IUPAC name is 3-N-(5-acetyl-2-methoxyphenyl)-4-chloro-1-N-hydroxybenzene-1,3-dicarboxamide.
| Compound Name | 3-N-(5-acetyl-2-methoxyphenyl)-4-chloro-1-N-hydroxybenzene-1,3-dicarboxamide |
|---|---|
| PubChem CID | 164624154 |
| Molecular Formula | C17H15ClN2O5 |
| Molecular Weight | 362.77 g/mol |
| Exact Mass | 362.07 |
| IUPAC Name | 3-N-(5-acetyl-2-methoxyphenyl)-4-chloro-1-N-hydroxybenzene-1,3-dicarboxamide |
| SMILES | COc1ccc(C(C)=O)cc1NC(=O)c1cc(C(=O)NO)ccc1Cl |
| InChI | InChI=1S/C17H15ClN2O5/c1-9(21)10-4-6-15(25-2)14(8-10)19-17(23)12-7-11(16(22)20-24)3-5-13(12)18/h3-8,24H,1-2H3,(H,19,23)(H,20,22) |
| InChIKey | RHPDEYIVLYNXPS-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.77 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|