C19H20N2O5 — CID 164620621
3-N-(5-acetyl-2-ethoxyphenyl)-1-N-hydroxy-4-methylbenzene-1,3-dicarboxamide (PubChem CID 164620621) has the molecular formula C19H20N2O5 and a molecular weight of 356.38 g/mol. Its IUPAC name is 3-N-(5-acetyl-2-ethoxyphenyl)-1-N-hydroxy-4-methylbenzene-1,3-dicarboxamide.
| Compound Name | 3-N-(5-acetyl-2-ethoxyphenyl)-1-N-hydroxy-4-methylbenzene-1,3-dicarboxamide |
|---|---|
| PubChem CID | 164620621 |
| Molecular Formula | C19H20N2O5 |
| Molecular Weight | 356.38 g/mol |
| Exact Mass | 356.14 |
| IUPAC Name | 3-N-(5-acetyl-2-ethoxyphenyl)-1-N-hydroxy-4-methylbenzene-1,3-dicarboxamide |
| SMILES | CCOc1ccc(C(C)=O)cc1NC(=O)c1cc(C(=O)NO)ccc1C |
| InChI | InChI=1S/C19H20N2O5/c1-4-26-17-8-7-13(12(3)22)10-16(17)20-19(24)15-9-14(18(23)21-25)6-5-11(15)2/h5-10,25H,4H2,1-3H3,(H,20,24)(H,21,23) |
| InChIKey | VXWRRICMEGNZFK-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.38 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|