About 6-(4-chloro-2-methylphenyl)-1-[4-(difluoromethoxy)phenyl]imidazo[4,5-c]pyridine
6-(4-chloro-2-methylphenyl)-1-[4-(difluoromethoxy)phenyl]imidazo[4,5-c]pyridine (PubChem CID 164625204) has the molecular formula C20H14ClF2N3O
and a molecular weight of 385.80 g/mol. Its IUPAC name is 6-(4-chloro-2-methylphenyl)-1-[4-(difluoromethoxy)phenyl]imidazo[4,5-c]pyridine.
Molecular Properties
| Compound Name | 6-(4-chloro-2-methylphenyl)-1-[4-(difluoromethoxy)phenyl]imidazo[4,5-c]pyridine |
| PubChem CID | 164625204 |
| Molecular Formula | C20H14ClF2N3O |
| Molecular Weight | 385.80 g/mol |
| Exact Mass | 385.08 |
| IUPAC Name | 6-(4-chloro-2-methylphenyl)-1-[4-(difluoromethoxy)phenyl]imidazo[4,5-c]pyridine |
| SMILES | Cc1cc(Cl)ccc1-c1cc2c(cn1)ncn2-c1ccc(OC(F)F)cc1 |
| InChI | InChI=1S/C20H14ClF2N3O/c1-12-8-13(21)2-7-16(12)17-9-19-18(10-24-17)25-11-26(19)14-3-5-15(6-4-14)27-20(22)23/h2-11,20H,1H3 |
| InChIKey | KIYOJBZNLXHFSV-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 39.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 385.80 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 6-(4-chloro-2-methylphenyl)-1-[4-(difluoromethoxy)phenyl]imidazo[4,5-c]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(4-chloro-2-methylphenyl)-1-[4-(difluoromethoxy)phenyl]imidazo[4,5-c]pyridine?
The IUPAC name of 6-(4-chloro-2-methylphenyl)-1-[4-(difluoromethoxy)phenyl]imidazo[4,5-c]pyridine (CID 164625204) is 6-(4-chloro-2-methylphenyl)-1-[4-(difluoromethoxy)phenyl]imidazo[4,5-c]pyridine.
What is the SMILES notation for 6-(4-chloro-2-methylphenyl)-1-[4-(difluoromethoxy)phenyl]imidazo[4,5-c]pyridine?
The canonical SMILES for 6-(4-chloro-2-methylphenyl)-1-[4-(difluoromethoxy)phenyl]imidazo[4,5-c]pyridine is Cc1cc(Cl)ccc1-c1cc2c(cn1)ncn2-c1ccc(OC(F)F)cc1.
What is the InChIKey of 6-(4-chloro-2-methylphenyl)-1-[4-(difluoromethoxy)phenyl]imidazo[4,5-c]pyridine?
The InChIKey is KIYOJBZNLXHFSV-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H14ClF2N3O/c1-12-8-13(21)2-7-16(12)17-9-19-18(10-24-17)25-11-26(19)14-3-5-15(6-4-14)27-20(22)23/h2-11,20H,1H3.
What are the key properties of 6-(4-chloro-2-methylphenyl)-1-[4-(difluoromethoxy)phenyl]imidazo[4,5-c]pyridine?
6-(4-chloro-2-methylphenyl)-1-[4-(difluoromethoxy)phenyl]imidazo[4,5-c]pyridine has a molecular weight of 385.80 g/mol, XLogP of 5.65, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(4-chloro-2-methylphenyl)-1-[4-(difluoromethoxy)phenyl]imidazo[4,5-c]pyridine is sourced from PubChem (CID 164625204), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).