C12H15F3N2O2 — CID 164627556
(1S,2S,4S)-N-[2-[(2,2,2-trifluoroacetyl)amino]ethyl]bicyclo[2.2.1]hept-5-ene-2-carboxamide (PubChem CID 164627556) has the molecular formula C12H15F3N2O2 and a molecular weight of 276.26 g/mol. Its IUPAC name is (1S,2S,4S)-N-[2-[(2,2,2-trifluoroacetyl)amino]ethyl]bicyclo[2.2.1]hept-5-ene-2-carboxamide.
| Compound Name | (1S,2S,4S)-N-[2-[(2,2,2-trifluoroacetyl)amino]ethyl]bicyclo[2.2.1]hept-5-ene-2-carboxamide |
|---|---|
| PubChem CID | 164627556 |
| Molecular Formula | C12H15F3N2O2 |
| Molecular Weight | 276.26 g/mol |
| Exact Mass | 276.11 |
| IUPAC Name | (1S,2S,4S)-N-[2-[(2,2,2-trifluoroacetyl)amino]ethyl]bicyclo[2.2.1]hept-5-ene-2-carboxamide |
| SMILES | O=C(NCCNC(=O)C(F)(F)F)[C@H]1C[C@H]2C=C[C@@H]1C2 |
| InChI | InChI=1S/C12H15F3N2O2/c13-12(14,15)11(19)17-4-3-16-10(18)9-6-7-1-2-8(9)5-7/h1-2,7-9H,3-6H2,(H,16,18)(H,17,19)/t7-,8+,9-/m0/s1 |
| InChIKey | GDCFAKHIIGVLEI-YIZRAAEISA-N |
| XLogP | 0.99 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.26 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|