C12H12F7NO — CID 134980056
(1S,2R,3R,4R)-3-(1,1,2,2,3,3,3-heptafluoropropyl)-N-methylbicyclo[2.2.1]hept-5-ene-2-carboxamide (PubChem CID 134980056) has the molecular formula C12H12F7NO and a molecular weight of 319.22 g/mol. Its IUPAC name is (1S,2R,3R,4R)-3-(1,1,2,2,3,3,3-heptafluoropropyl)-N-methylbicyclo[2.2.1]hept-5-ene-2-carboxamide.
| Compound Name | (1S,2R,3R,4R)-3-(1,1,2,2,3,3,3-heptafluoropropyl)-N-methylbicyclo[2.2.1]hept-5-ene-2-carboxamide |
|---|---|
| PubChem CID | 134980056 |
| Molecular Formula | C12H12F7NO |
| Molecular Weight | 319.22 g/mol |
| Exact Mass | 319.08 |
| IUPAC Name | (1S,2R,3R,4R)-3-(1,1,2,2,3,3,3-heptafluoropropyl)-N-methylbicyclo[2.2.1]hept-5-ene-2-carboxamide |
| SMILES | CNC(=O)[C@H]1[C@H](C(F)(F)C(F)(F)C(F)(F)F)[C@H]2C=C[C@@H]1C2 |
| InChI | InChI=1S/C12H12F7NO/c1-20-9(21)7-5-2-3-6(4-5)8(7)10(13,14)11(15,16)12(17,18)19/h2-3,5-8H,4H2,1H3,(H,20,21)/t5-,6+,7-,8-/m1/s1 |
| InChIKey | WQNBLXXLUQMHQR-ULAWRXDQSA-N |
| XLogP | 3.00 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.22 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|