C10H14FNO — CID 130626747
N-(2-fluoroethyl)bicyclo[2.2.1]hept-5-ene-2-carboxamide (PubChem CID 130626747) has the molecular formula C10H14FNO and a molecular weight of 183.23 g/mol. Its IUPAC name is N-(2-fluoroethyl)bicyclo[2.2.1]hept-5-ene-2-carboxamide.
| Compound Name | N-(2-fluoroethyl)bicyclo[2.2.1]hept-5-ene-2-carboxamide |
|---|---|
| PubChem CID | 130626747 |
| Molecular Formula | C10H14FNO |
| Molecular Weight | 183.23 g/mol |
| Exact Mass | 183.11 |
| IUPAC Name | N-(2-fluoroethyl)bicyclo[2.2.1]hept-5-ene-2-carboxamide |
| SMILES | O=C(NCCF)C1CC2C=CC1C2 |
| InChI | InChI=1S/C10H14FNO/c11-3-4-12-10(13)9-6-7-1-2-8(9)5-7/h1-2,7-9H,3-6H2,(H,12,13) |
| InChIKey | PVQBJHGTULEQOZ-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.23 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|