C33H39N3O4 — CID 164627679
1-[(2S)-2-(hexanoylamino)-2-(4-phenylmethoxyphenyl)acetyl]-N-phenylpiperidine-4-carboxamide (PubChem CID 164627679) has the molecular formula C33H39N3O4 and a molecular weight of 541.69 g/mol. Its IUPAC name is 1-[(2S)-2-(hexanoylamino)-2-(4-phenylmethoxyphenyl)acetyl]-N-phenylpiperidine-4-carboxamide.
| Compound Name | 1-[(2S)-2-(hexanoylamino)-2-(4-phenylmethoxyphenyl)acetyl]-N-phenylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 164627679 |
| Molecular Formula | C33H39N3O4 |
| Molecular Weight | 541.69 g/mol |
| Exact Mass | 541.29 |
| IUPAC Name | 1-[(2S)-2-(hexanoylamino)-2-(4-phenylmethoxyphenyl)acetyl]-N-phenylpiperidine-4-carboxamide |
| SMILES | CCCCCC(=O)N[C@H](C(=O)N1CCC(C(=O)Nc2ccccc2)CC1)c1ccc(OCc2ccccc2)cc1 |
| InChI | InChI=1S/C33H39N3O4/c1-2-3-6-15-30(37)35-31(26-16-18-29(19-17-26)40-24-25-11-7-4-8-12-25)33(39)36-22-20-27(21-23-36)32(38)34-28-13-9-5-10-14-28/h4-5,7-14,16-19,27,31H,2-3,6,15,20-24H2,1H3,(H,34,38)(H,35,37)/t31-/m0/s1 |
| InChIKey | WUPBOIFEUCRROC-HKBQPEDESA-N |
| XLogP | 5.88 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.69 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|