C22H26Cl2N6O2 — CID 164627715
4-(cyclopropylamino)-2-[(2,5-dichlorophenyl)methylamino]-N-[3-(2-oxopyrrolidin-1-yl)propyl]pyrimidine-5-carboxamide (PubChem CID 164627715) has the molecular formula C22H26Cl2N6O2 and a molecular weight of 477.40 g/mol. Its IUPAC name is 4-(cyclopropylamino)-2-[(2,5-dichlorophenyl)methylamino]-N-[3-(2-oxopyrrolidin-1-yl)propyl]pyrimidine-5-carboxamide.
| Compound Name | 4-(cyclopropylamino)-2-[(2,5-dichlorophenyl)methylamino]-N-[3-(2-oxopyrrolidin-1-yl)propyl]pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 164627715 |
| Molecular Formula | C22H26Cl2N6O2 |
| Molecular Weight | 477.40 g/mol |
| Exact Mass | 476.15 |
| IUPAC Name | 4-(cyclopropylamino)-2-[(2,5-dichlorophenyl)methylamino]-N-[3-(2-oxopyrrolidin-1-yl)propyl]pyrimidine-5-carboxamide |
| SMILES | O=C(NCCCN1CCCC1=O)c1cnc(NCc2cc(Cl)ccc2Cl)nc1NC1CC1 |
| InChI | InChI=1S/C22H26Cl2N6O2/c23-15-4-7-18(24)14(11-15)12-26-22-27-13-17(20(29-22)28-16-5-6-16)21(32)25-8-2-10-30-9-1-3-19(30)31/h4,7,11,13,16H,1-3,5-6,8-10,12H2,(H,25,32)(H2,26,27,28,29) |
| InChIKey | QWINAFZLCXMYIY-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 99.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.40 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|