C26H24N4O6 — CID 164627838
methyl 4-[[2-oxo-2-[(2S)-1-[2-(quinoline-4-carbonylamino)acetyl]pyrrolidin-2-yl]acetyl]amino]benzoate (PubChem CID 164627838) has the molecular formula C26H24N4O6 and a molecular weight of 488.50 g/mol. Its IUPAC name is methyl 4-[[2-oxo-2-[(2S)-1-[2-(quinoline-4-carbonylamino)acetyl]pyrrolidin-2-yl]acetyl]amino]benzoate.
| Compound Name | methyl 4-[[2-oxo-2-[(2S)-1-[2-(quinoline-4-carbonylamino)acetyl]pyrrolidin-2-yl]acetyl]amino]benzoate |
|---|---|
| PubChem CID | 164627838 |
| Molecular Formula | C26H24N4O6 |
| Molecular Weight | 488.50 g/mol |
| Exact Mass | 488.17 |
| IUPAC Name | methyl 4-[[2-oxo-2-[(2S)-1-[2-(quinoline-4-carbonylamino)acetyl]pyrrolidin-2-yl]acetyl]amino]benzoate |
| SMILES | COC(=O)c1ccc(NC(=O)C(=O)[C@@H]2CCCN2C(=O)CNC(=O)c2ccnc3ccccc23)cc1 |
| InChI | InChI=1S/C26H24N4O6/c1-36-26(35)16-8-10-17(11-9-16)29-25(34)23(32)21-7-4-14-30(21)22(31)15-28-24(33)19-12-13-27-20-6-3-2-5-18(19)20/h2-3,5-6,8-13,21H,4,7,14-15H2,1H3,(H,28,33)(H,29,34)/t21-/m0/s1 |
| InChIKey | WJVFWJBYVQKOCW-NRFANRHFSA-N |
| XLogP | 1.95 |
| TPSA | 134.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.50 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|