C20H13F2N3 — CID 164628039
N-[2-(2,5-difluorophenyl)-4-pyridinyl]quinolin-4-amine (PubChem CID 164628039) has the molecular formula C20H13F2N3 and a molecular weight of 333.34 g/mol. Its IUPAC name is N-[2-(2,5-difluorophenyl)-4-pyridinyl]quinolin-4-amine.
| Compound Name | N-[2-(2,5-difluorophenyl)-4-pyridinyl]quinolin-4-amine |
|---|---|
| PubChem CID | 164628039 |
| Molecular Formula | C20H13F2N3 |
| Molecular Weight | 333.34 g/mol |
| Exact Mass | 333.11 |
| IUPAC Name | N-[2-(2,5-difluorophenyl)-4-pyridinyl]quinolin-4-amine |
| SMILES | Fc1ccc(F)c(-c2cc(Nc3ccnc4ccccc34)ccn2)c1 |
| InChI | InChI=1S/C20H13F2N3/c21-13-5-6-17(22)16(11-13)20-12-14(7-9-24-20)25-19-8-10-23-18-4-2-1-3-15(18)19/h1-12H,(H,23,24,25) |
| InChIKey | YFUBIZQBUUEVQR-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.34 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |