C19H18N2O4 — CID 164628172
5-nitro-1-(4-phenylbutyl)indole-2-carboxylic acid (PubChem CID 164628172) has the molecular formula C19H18N2O4 and a molecular weight of 338.36 g/mol. Its IUPAC name is 5-nitro-1-(4-phenylbutyl)indole-2-carboxylic acid.
| Compound Name | 5-nitro-1-(4-phenylbutyl)indole-2-carboxylic acid |
|---|---|
| PubChem CID | 164628172 |
| Molecular Formula | C19H18N2O4 |
| Molecular Weight | 338.36 g/mol |
| Exact Mass | 338.13 |
| IUPAC Name | 5-nitro-1-(4-phenylbutyl)indole-2-carboxylic acid |
| SMILES | O=C(O)c1cc2cc([N+](=O)[O-])ccc2n1CCCCc1ccccc1 |
| InChI | InChI=1S/C19H18N2O4/c22-19(23)18-13-15-12-16(21(24)25)9-10-17(15)20(18)11-5-4-8-14-6-2-1-3-7-14/h1-3,6-7,9-10,12-13H,4-5,8,11H2,(H,22,23) |
| InChIKey | ZXOLYBWEKRAABC-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 85.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.36 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|