C24H24N2O6 — CID 70384390
2,6-dimethyl-4-(4-nitrophenyl)-1-(3-phenylpropyl)-4H-pyridine-3,5-dicarboxylic acid (PubChem CID 70384390) has the molecular formula C24H24N2O6 and a molecular weight of 436.46 g/mol. Its IUPAC name is 2,6-dimethyl-4-(4-nitrophenyl)-1-(3-phenylpropyl)-4H-pyridine-3,5-dicarboxylic acid.
| Compound Name | 2,6-dimethyl-4-(4-nitrophenyl)-1-(3-phenylpropyl)-4H-pyridine-3,5-dicarboxylic acid |
|---|---|
| PubChem CID | 70384390 |
| Molecular Formula | C24H24N2O6 |
| Molecular Weight | 436.46 g/mol |
| Exact Mass | 436.16 |
| IUPAC Name | 2,6-dimethyl-4-(4-nitrophenyl)-1-(3-phenylpropyl)-4H-pyridine-3,5-dicarboxylic acid |
| SMILES | CC1=C(C(=O)O)C(c2ccc([N+](=O)[O-])cc2)C(C(=O)O)=C(C)N1CCCc1ccccc1 |
| InChI | InChI=1S/C24H24N2O6/c1-15-20(23(27)28)22(18-10-12-19(13-11-18)26(31)32)21(24(29)30)16(2)25(15)14-6-9-17-7-4-3-5-8-17/h3-5,7-8,10-13,22H,6,9,14H2,1-2H3,(H,27,28)(H,29,30) |
| InChIKey | VZODARMWLQJQBT-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 120.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.46 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|