C22H20N2O6 — CID 88826547
5-hexa-1,5-diynoxycarbonyl-1,2,6-trimethyl-4-(4-nitrophenyl)-4H-pyridine-3-carboxylic acid (PubChem CID 88826547) has the molecular formula C22H20N2O6 and a molecular weight of 408.41 g/mol. Its IUPAC name is 5-hexa-1,5-diynoxycarbonyl-1,2,6-trimethyl-4-(4-nitrophenyl)-4H-pyridine-3-carboxylic acid.
| Compound Name | 5-hexa-1,5-diynoxycarbonyl-1,2,6-trimethyl-4-(4-nitrophenyl)-4H-pyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 88826547 |
| Molecular Formula | C22H20N2O6 |
| Molecular Weight | 408.41 g/mol |
| Exact Mass | 408.13 |
| IUPAC Name | 5-hexa-1,5-diynoxycarbonyl-1,2,6-trimethyl-4-(4-nitrophenyl)-4H-pyridine-3-carboxylic acid |
| SMILES | C#CCCC#COC(=O)C1=C(C)N(C)C(C)=C(C(=O)O)C1c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C22H20N2O6/c1-5-6-7-8-13-30-22(27)19-15(3)23(4)14(2)18(21(25)26)20(19)16-9-11-17(12-10-16)24(28)29/h1,9-12,20H,6-7H2,2-4H3,(H,25,26) |
| InChIKey | IGTAXDXMEWHULH-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 109.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.41 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|