C19H14N6O2 — CID 164628502
2-[4-[4-[5-(hydroxymethyl)furan-2-yl]-3,8,10-triazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-3-yl]pyrazol-1-yl]acetonitrile (PubChem CID 164628502) has the molecular formula C19H14N6O2 and a molecular weight of 358.36 g/mol. Its IUPAC name is 2-[4-[4-[5-(hydroxymethyl)furan-2-yl]-3,8,10-triazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-3-yl]pyrazol-1-yl]acetonitrile.
| Compound Name | 2-[4-[4-[5-(hydroxymethyl)furan-2-yl]-3,8,10-triazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-3-yl]pyrazol-1-yl]acetonitrile |
|---|---|
| PubChem CID | 164628502 |
| Molecular Formula | C19H14N6O2 |
| Molecular Weight | 358.36 g/mol |
| Exact Mass | 358.12 |
| IUPAC Name | 2-[4-[4-[5-(hydroxymethyl)furan-2-yl]-3,8,10-triazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-3-yl]pyrazol-1-yl]acetonitrile |
| SMILES | N#CCn1cc(-n2c(-c3ccc(CO)o3)cc3cnc4[nH]ccc4c32)cn1 |
| InChI | InChI=1S/C19H14N6O2/c20-4-6-24-10-13(9-23-24)25-16(17-2-1-14(11-26)27-17)7-12-8-22-19-15(18(12)25)3-5-21-19/h1-3,5,7-10,26H,6,11H2,(H,21,22) |
| InChIKey | LEZRCXPZFMLICL-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 108.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.36 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |