C17H22N6O4S — CID 164629073
ethyl 2-[4-(propan-2-ylamino)-2-(4-sulfamoylanilino)pyrimidin-5-yl]iminoacetate (PubChem CID 164629073) has the molecular formula C17H22N6O4S and a molecular weight of 406.47 g/mol. Its IUPAC name is ethyl 2-[4-(propan-2-ylamino)-2-(4-sulfamoylanilino)pyrimidin-5-yl]iminoacetate.
| Compound Name | ethyl 2-[4-(propan-2-ylamino)-2-(4-sulfamoylanilino)pyrimidin-5-yl]iminoacetate |
|---|---|
| PubChem CID | 164629073 |
| Molecular Formula | C17H22N6O4S |
| Molecular Weight | 406.47 g/mol |
| Exact Mass | 406.14 |
| IUPAC Name | ethyl 2-[4-(propan-2-ylamino)-2-(4-sulfamoylanilino)pyrimidin-5-yl]iminoacetate |
| SMILES | CCOC(=O)/C=N/c1cnc(Nc2ccc(S(N)(=O)=O)cc2)nc1NC(C)C |
| InChI | InChI=1S/C17H22N6O4S/c1-4-27-15(24)10-19-14-9-20-17(23-16(14)21-11(2)3)22-12-5-7-13(8-6-12)28(18,25)26/h5-11H,4H2,1-3H3,(H2,18,25,26)(H2,20,21,22,23)/b19-10+ |
| InChIKey | AJJGTGWRALCAQW-VXLYETTFSA-N |
| XLogP | 1.95 |
| TPSA | 148.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.47 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|