C30H32N2O5 — CID 164629153
(2S)-1-[(E)-3-(3-methoxy-4-phenylmethoxyphenyl)prop-2-enoyl]-N-(2-phenoxyethyl)pyrrolidine-2-carboxamide (PubChem CID 164629153) has the molecular formula C30H32N2O5 and a molecular weight of 500.60 g/mol. Its IUPAC name is (2S)-1-[(E)-3-(3-methoxy-4-phenylmethoxyphenyl)prop-2-enoyl]-N-(2-phenoxyethyl)pyrrolidine-2-carboxamide.
| Compound Name | (2S)-1-[(E)-3-(3-methoxy-4-phenylmethoxyphenyl)prop-2-enoyl]-N-(2-phenoxyethyl)pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 164629153 |
| Molecular Formula | C30H32N2O5 |
| Molecular Weight | 500.60 g/mol |
| Exact Mass | 500.23 |
| IUPAC Name | (2S)-1-[(E)-3-(3-methoxy-4-phenylmethoxyphenyl)prop-2-enoyl]-N-(2-phenoxyethyl)pyrrolidine-2-carboxamide |
| SMILES | COc1cc(/C=C/C(=O)N2CCC[C@H]2C(=O)NCCOc2ccccc2)ccc1OCc1ccccc1 |
| InChI | InChI=1S/C30H32N2O5/c1-35-28-21-23(14-16-27(28)37-22-24-9-4-2-5-10-24)15-17-29(33)32-19-8-13-26(32)30(34)31-18-20-36-25-11-6-3-7-12-25/h2-7,9-12,14-17,21,26H,8,13,18-20,22H2,1H3,(H,31,34)/b17-15+/t26-/m0/s1 |
| InChIKey | BTKNKNKBXJCIAO-DSDNZOFKSA-N |
| XLogP | 4.47 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.60 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|