C17H18N4O2 — CID 164631126
[(3aR,6S,6aS)-6-hydroxy-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]pyrrol-1-yl]-(2-pyridin-2-ylpyrimidin-4-yl)methanone (PubChem CID 164631126) has the molecular formula C17H18N4O2 and a molecular weight of 310.36 g/mol. Its IUPAC name is [(3aR,6S,6aS)-6-hydroxy-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]pyrrol-1-yl]-(2-pyridin-2-ylpyrimidin-4-yl)methanone.
| Compound Name | [(3aR,6S,6aS)-6-hydroxy-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]pyrrol-1-yl]-(2-pyridin-2-ylpyrimidin-4-yl)methanone |
|---|---|
| PubChem CID | 164631126 |
| Molecular Formula | C17H18N4O2 |
| Molecular Weight | 310.36 g/mol |
| Exact Mass | 310.14 |
| IUPAC Name | [(3aR,6S,6aS)-6-hydroxy-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]pyrrol-1-yl]-(2-pyridin-2-ylpyrimidin-4-yl)methanone |
| SMILES | O=C(c1ccnc(-c2ccccn2)n1)N1CC[C@H]2CC[C@H](O)[C@H]21 |
| InChI | InChI=1S/C17H18N4O2/c22-14-5-4-11-7-10-21(15(11)14)17(23)13-6-9-19-16(20-13)12-3-1-2-8-18-12/h1-3,6,8-9,11,14-15,22H,4-5,7,10H2/t11-,14+,15+/m1/s1 |
| InChIKey | JLOLAJHRGLPJOD-UGFHNGPFSA-N |
| XLogP | 1.52 |
| TPSA | 79.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.36 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |