C20H25FN2O2 — CID 164631617
N-[(S)-(5-fluoro-2-methoxyphenyl)-(3-methoxyphenyl)methyl]piperidin-4-amine (PubChem CID 164631617) has the molecular formula C20H25FN2O2 and a molecular weight of 344.43 g/mol. Its IUPAC name is N-[(S)-(5-fluoro-2-methoxyphenyl)-(3-methoxyphenyl)methyl]piperidin-4-amine.
| Compound Name | N-[(S)-(5-fluoro-2-methoxyphenyl)-(3-methoxyphenyl)methyl]piperidin-4-amine |
|---|---|
| PubChem CID | 164631617 |
| Molecular Formula | C20H25FN2O2 |
| Molecular Weight | 344.43 g/mol |
| Exact Mass | 344.19 |
| IUPAC Name | N-[(S)-(5-fluoro-2-methoxyphenyl)-(3-methoxyphenyl)methyl]piperidin-4-amine |
| SMILES | COc1cccc([C@H](NC2CCNCC2)c2cc(F)ccc2OC)c1 |
| InChI | InChI=1S/C20H25FN2O2/c1-24-17-5-3-4-14(12-17)20(23-16-8-10-22-11-9-16)18-13-15(21)6-7-19(18)25-2/h3-7,12-13,16,20,22-23H,8-11H2,1-2H3/t20-/m0/s1 |
| InChIKey | ICGRBVCJODVSCY-FQEVSTJZSA-N |
| XLogP | 3.27 |
| TPSA | 42.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.43 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |