C20H26ClFN2O4 — CID 119809465
N-[(5-fluoro-2-methoxyphenyl)-(3-methoxyphenyl)methyl]-2-(2-methoxyethylamino)acetamide;hydrochloride (PubChem CID 119809465) has the molecular formula C20H26ClFN2O4 and a molecular weight of 412.89 g/mol. Its IUPAC name is N-[(5-fluoro-2-methoxyphenyl)-(3-methoxyphenyl)methyl]-2-(2-methoxyethylamino)acetamide;hydrochloride.
| Compound Name | N-[(5-fluoro-2-methoxyphenyl)-(3-methoxyphenyl)methyl]-2-(2-methoxyethylamino)acetamide;hydrochloride |
|---|---|
| PubChem CID | 119809465 |
| Molecular Formula | C20H26ClFN2O4 |
| Molecular Weight | 412.89 g/mol |
| Exact Mass | 412.16 |
| IUPAC Name | N-[(5-fluoro-2-methoxyphenyl)-(3-methoxyphenyl)methyl]-2-(2-methoxyethylamino)acetamide;hydrochloride |
| SMILES | COCCNCC(=O)NC(c1cccc(OC)c1)c1cc(F)ccc1OC.Cl |
| InChI | InChI=1S/C20H25FN2O4.ClH/c1-25-10-9-22-13-19(24)23-20(14-5-4-6-16(11-14)26-2)17-12-15(21)7-8-18(17)27-3;/h4-8,11-12,20,22H,9-10,13H2,1-3H3,(H,23,24);1H |
| InChIKey | JIYOHLFDQHPNEA-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 68.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.89 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|