C16H22N2O4 — CID 164633014
(2S)-N-(2,5-dimethoxyphenyl)-2-methyl-7-oxoazepane-2-carboxamide (PubChem CID 164633014) has the molecular formula C16H22N2O4 and a molecular weight of 306.36 g/mol. Its IUPAC name is (2S)-N-(2,5-dimethoxyphenyl)-2-methyl-7-oxoazepane-2-carboxamide.
| Compound Name | (2S)-N-(2,5-dimethoxyphenyl)-2-methyl-7-oxoazepane-2-carboxamide |
|---|---|
| PubChem CID | 164633014 |
| Molecular Formula | C16H22N2O4 |
| Molecular Weight | 306.36 g/mol |
| Exact Mass | 306.16 |
| IUPAC Name | (2S)-N-(2,5-dimethoxyphenyl)-2-methyl-7-oxoazepane-2-carboxamide |
| SMILES | COc1ccc(OC)c(NC(=O)[C@]2(C)CCCCC(=O)N2)c1 |
| InChI | InChI=1S/C16H22N2O4/c1-16(9-5-4-6-14(19)18-16)15(20)17-12-10-11(21-2)7-8-13(12)22-3/h7-8,10H,4-6,9H2,1-3H3,(H,17,20)(H,18,19)/t16-/m0/s1 |
| InChIKey | DYCDNXQTDFEABS-INIZCTEOSA-N |
| XLogP | 2.09 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.36 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |