C22H26N2O4 — CID 91919465
2-benzyl-N-(2,5-dimethoxyphenyl)-7-oxoazepane-2-carboxamide (PubChem CID 91919465) has the molecular formula C22H26N2O4 and a molecular weight of 382.46 g/mol. Its IUPAC name is 2-benzyl-N-(2,5-dimethoxyphenyl)-7-oxoazepane-2-carboxamide.
| Compound Name | 2-benzyl-N-(2,5-dimethoxyphenyl)-7-oxoazepane-2-carboxamide |
|---|---|
| PubChem CID | 91919465 |
| Molecular Formula | C22H26N2O4 |
| Molecular Weight | 382.46 g/mol |
| Exact Mass | 382.19 |
| IUPAC Name | 2-benzyl-N-(2,5-dimethoxyphenyl)-7-oxoazepane-2-carboxamide |
| SMILES | COc1ccc(OC)c(NC(=O)C2(Cc3ccccc3)CCCCC(=O)N2)c1 |
| InChI | InChI=1S/C22H26N2O4/c1-27-17-11-12-19(28-2)18(14-17)23-21(26)22(13-7-6-10-20(25)24-22)15-16-8-4-3-5-9-16/h3-5,8-9,11-12,14H,6-7,10,13,15H2,1-2H3,(H,23,26)(H,24,25) |
| InChIKey | PLSZXISXZCZVFJ-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.46 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |