C21H26N4O3 — CID 164634604
(2S)-N-(3-benzamidophenyl)-2-[(dimethylamino)methyl]morpholine-4-carboxamide (PubChem CID 164634604) has the molecular formula C21H26N4O3 and a molecular weight of 382.46 g/mol. Its IUPAC name is (2S)-N-(3-benzamidophenyl)-2-[(dimethylamino)methyl]morpholine-4-carboxamide.
| Compound Name | (2S)-N-(3-benzamidophenyl)-2-[(dimethylamino)methyl]morpholine-4-carboxamide |
|---|---|
| PubChem CID | 164634604 |
| Molecular Formula | C21H26N4O3 |
| Molecular Weight | 382.46 g/mol |
| Exact Mass | 382.20 |
| IUPAC Name | (2S)-N-(3-benzamidophenyl)-2-[(dimethylamino)methyl]morpholine-4-carboxamide |
| SMILES | CN(C)C[C@H]1CN(C(=O)Nc2cccc(NC(=O)c3ccccc3)c2)CCO1 |
| InChI | InChI=1S/C21H26N4O3/c1-24(2)14-19-15-25(11-12-28-19)21(27)23-18-10-6-9-17(13-18)22-20(26)16-7-4-3-5-8-16/h3-10,13,19H,11-12,14-15H2,1-2H3,(H,22,26)(H,23,27)/t19-/m0/s1 |
| InChIKey | WJBAAVYUAFZJRL-IBGZPJMESA-N |
| XLogP | 2.73 |
| TPSA | 73.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.46 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |