C15H18N4O2S — CID 164636883
[(2S)-2-(3-methyl-1,2,4-oxadiazol-5-yl)pyrrolidin-1-yl]-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)methanone (PubChem CID 164636883) has the molecular formula C15H18N4O2S and a molecular weight of 318.40 g/mol. Its IUPAC name is [(2S)-2-(3-methyl-1,2,4-oxadiazol-5-yl)pyrrolidin-1-yl]-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)methanone.
| Compound Name | [(2S)-2-(3-methyl-1,2,4-oxadiazol-5-yl)pyrrolidin-1-yl]-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)methanone |
|---|---|
| PubChem CID | 164636883 |
| Molecular Formula | C15H18N4O2S |
| Molecular Weight | 318.40 g/mol |
| Exact Mass | 318.12 |
| IUPAC Name | [(2S)-2-(3-methyl-1,2,4-oxadiazol-5-yl)pyrrolidin-1-yl]-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)methanone |
| SMILES | Cc1noc([C@@H]2CCCN2C(=O)c2nc3c(s2)CCCC3)n1 |
| InChI | InChI=1S/C15H18N4O2S/c1-9-16-13(21-18-9)11-6-4-8-19(11)15(20)14-17-10-5-2-3-7-12(10)22-14/h11H,2-8H2,1H3/t11-/m0/s1 |
| InChIKey | GLVKBHASIUJVKB-NSHDSACASA-N |
| XLogP | 2.69 |
| TPSA | 72.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.40 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |