C15H19N3O2 — CID 164637742
(3S,4S)-1-[(3-methylimidazol-4-yl)methyl]-4-phenoxypyrrolidin-3-ol (PubChem CID 164637742) has the molecular formula C15H19N3O2 and a molecular weight of 273.34 g/mol. Its IUPAC name is (3S,4S)-1-[(3-methylimidazol-4-yl)methyl]-4-phenoxypyrrolidin-3-ol.
| Compound Name | (3S,4S)-1-[(3-methylimidazol-4-yl)methyl]-4-phenoxypyrrolidin-3-ol |
|---|---|
| PubChem CID | 164637742 |
| Molecular Formula | C15H19N3O2 |
| Molecular Weight | 273.34 g/mol |
| Exact Mass | 273.15 |
| IUPAC Name | (3S,4S)-1-[(3-methylimidazol-4-yl)methyl]-4-phenoxypyrrolidin-3-ol |
| SMILES | Cn1cncc1CN1C[C@H](Oc2ccccc2)[C@@H](O)C1 |
| InChI | InChI=1S/C15H19N3O2/c1-17-11-16-7-12(17)8-18-9-14(19)15(10-18)20-13-5-3-2-4-6-13/h2-7,11,14-15,19H,8-10H2,1H3/t14-,15-/m0/s1 |
| InChIKey | VHNKXRAAHBQKNV-GJZGRUSLSA-N |
| XLogP | 1.04 |
| TPSA | 50.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.34 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |