About N-[[(1S,2R)-2-cyclobutylcyclopropyl]methyl]-5-oxopyrrolidine-3-carboxamide
N-[[(1S,2R)-2-cyclobutylcyclopropyl]methyl]-5-oxopyrrolidine-3-carboxamide (PubChem CID 164638984) has the molecular formula C13H20N2O2
and a molecular weight of 236.31 g/mol. Its IUPAC name is N-[[(1S,2R)-2-cyclobutylcyclopropyl]methyl]-5-oxopyrrolidine-3-carboxamide.
Molecular Properties
| Compound Name | N-[[(1S,2R)-2-cyclobutylcyclopropyl]methyl]-5-oxopyrrolidine-3-carboxamide |
| PubChem CID | 164638984 |
| Molecular Formula | C13H20N2O2 |
| Molecular Weight | 236.31 g/mol |
| Exact Mass | 236.15 |
| IUPAC Name | N-[[(1S,2R)-2-cyclobutylcyclopropyl]methyl]-5-oxopyrrolidine-3-carboxamide |
| SMILES | O=C1CC(C(=O)NC[C@H]2C[C@@H]2C2CCC2)CN1 |
| InChI | InChI=1S/C13H20N2O2/c16-12-5-10(7-14-12)13(17)15-6-9-4-11(9)8-2-1-3-8/h8-11H,1-7H2,(H,14,16)(H,15,17)/t9-,10?,11-/m1/s1 |
| InChIKey | JLXIEWQTKWPSCM-GLYLRITDSA-N |
| XLogP | 0.67 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.31 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-[[(1S,2R)-2-cyclobutylcyclopropyl]methyl]-5-oxopyrrolidine-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[[(1S,2R)-2-cyclobutylcyclopropyl]methyl]-5-oxopyrrolidine-3-carboxamide?
The IUPAC name of N-[[(1S,2R)-2-cyclobutylcyclopropyl]methyl]-5-oxopyrrolidine-3-carboxamide (CID 164638984) is N-[[(1S,2R)-2-cyclobutylcyclopropyl]methyl]-5-oxopyrrolidine-3-carboxamide.
What is the SMILES notation for N-[[(1S,2R)-2-cyclobutylcyclopropyl]methyl]-5-oxopyrrolidine-3-carboxamide?
The canonical SMILES for N-[[(1S,2R)-2-cyclobutylcyclopropyl]methyl]-5-oxopyrrolidine-3-carboxamide is O=C1CC(C(=O)NC[C@H]2C[C@@H]2C2CCC2)CN1.
What is the InChIKey of N-[[(1S,2R)-2-cyclobutylcyclopropyl]methyl]-5-oxopyrrolidine-3-carboxamide?
The InChIKey is JLXIEWQTKWPSCM-GLYLRITDSA-N. The full InChI is InChI=1S/C13H20N2O2/c16-12-5-10(7-14-12)13(17)15-6-9-4-11(9)8-2-1-3-8/h8-11H,1-7H2,(H,14,16)(H,15,17)/t9-,10?,11-/m1/s1.
What are the key properties of N-[[(1S,2R)-2-cyclobutylcyclopropyl]methyl]-5-oxopyrrolidine-3-carboxamide?
N-[[(1S,2R)-2-cyclobutylcyclopropyl]methyl]-5-oxopyrrolidine-3-carboxamide has a molecular weight of 236.31 g/mol, XLogP of 0.67, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[[(1S,2R)-2-cyclobutylcyclopropyl]methyl]-5-oxopyrrolidine-3-carboxamide is sourced from PubChem (CID 164638984), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).