C17H21NO3 — CID 164641131
1-[(1S,3S)-3-phenylcyclopentanecarbonyl]pyrrolidine-2-carboxylic acid (PubChem CID 164641131) has the molecular formula C17H21NO3 and a molecular weight of 287.36 g/mol. Its IUPAC name is 1-[(1S,3S)-3-phenylcyclopentanecarbonyl]pyrrolidine-2-carboxylic acid.
| Compound Name | 1-[(1S,3S)-3-phenylcyclopentanecarbonyl]pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 164641131 |
| Molecular Formula | C17H21NO3 |
| Molecular Weight | 287.36 g/mol |
| Exact Mass | 287.15 |
| IUPAC Name | 1-[(1S,3S)-3-phenylcyclopentanecarbonyl]pyrrolidine-2-carboxylic acid |
| SMILES | O=C(O)C1CCCN1C(=O)[C@H]1CC[C@H](c2ccccc2)C1 |
| InChI | InChI=1S/C17H21NO3/c19-16(18-10-4-7-15(18)17(20)21)14-9-8-13(11-14)12-5-2-1-3-6-12/h1-3,5-6,13-15H,4,7-11H2,(H,20,21)/t13-,14-,15?/m0/s1 |
| InChIKey | KGPSGNLAJBHVAI-ZYOSVBKOSA-N |
| XLogP | 2.65 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.36 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |