C14H23NO3 — CID 164641557
3-[(3R)-1-(2-methylpent-2-enoyl)piperidin-3-yl]propanoic acid (PubChem CID 164641557) has the molecular formula C14H23NO3 and a molecular weight of 253.34 g/mol. Its IUPAC name is 3-[(3R)-1-(2-methylpent-2-enoyl)piperidin-3-yl]propanoic acid.
| Compound Name | 3-[(3R)-1-(2-methylpent-2-enoyl)piperidin-3-yl]propanoic acid |
|---|---|
| PubChem CID | 164641557 |
| Molecular Formula | C14H23NO3 |
| Molecular Weight | 253.34 g/mol |
| Exact Mass | 253.17 |
| IUPAC Name | 3-[(3R)-1-(2-methylpent-2-enoyl)piperidin-3-yl]propanoic acid |
| SMILES | CCC=C(C)C(=O)N1CCC[C@H](CCC(=O)O)C1 |
| InChI | InChI=1S/C14H23NO3/c1-3-5-11(2)14(18)15-9-4-6-12(10-15)7-8-13(16)17/h5,12H,3-4,6-10H2,1-2H3,(H,16,17)/t12-/m1/s1 |
| InChIKey | KWESVBLPUCYRIE-GFCCVEGCSA-N |
| XLogP | 2.45 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.34 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|