C19H25N3O3 — CID 164641994
3-(4-methylpyrazol-1-yl)-N-[4-[[(2R)-oxan-2-yl]methoxy]phenyl]propanamide (PubChem CID 164641994) has the molecular formula C19H25N3O3 and a molecular weight of 343.43 g/mol. Its IUPAC name is 3-(4-methylpyrazol-1-yl)-N-[4-[[(2R)-oxan-2-yl]methoxy]phenyl]propanamide.
| Compound Name | 3-(4-methylpyrazol-1-yl)-N-[4-[[(2R)-oxan-2-yl]methoxy]phenyl]propanamide |
|---|---|
| PubChem CID | 164641994 |
| Molecular Formula | C19H25N3O3 |
| Molecular Weight | 343.43 g/mol |
| Exact Mass | 343.19 |
| IUPAC Name | 3-(4-methylpyrazol-1-yl)-N-[4-[[(2R)-oxan-2-yl]methoxy]phenyl]propanamide |
| SMILES | Cc1cnn(CCC(=O)Nc2ccc(OC[C@H]3CCCCO3)cc2)c1 |
| InChI | InChI=1S/C19H25N3O3/c1-15-12-20-22(13-15)10-9-19(23)21-16-5-7-17(8-6-16)25-14-18-4-2-3-11-24-18/h5-8,12-13,18H,2-4,9-11,14H2,1H3,(H,21,23)/t18-/m1/s1 |
| InChIKey | CUQHOBPCEFEKRX-GOSISDBHSA-N |
| XLogP | 3.17 |
| TPSA | 65.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.43 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |