C15H22N2O5 — CID 164642629
ethyl 1-methyl-3-[[2-[[(2R)-oxolan-2-yl]methoxy]acetyl]amino]pyrrole-2-carboxylate (PubChem CID 164642629) has the molecular formula C15H22N2O5 and a molecular weight of 310.35 g/mol. Its IUPAC name is ethyl 1-methyl-3-[[2-[[(2R)-oxolan-2-yl]methoxy]acetyl]amino]pyrrole-2-carboxylate.
| Compound Name | ethyl 1-methyl-3-[[2-[[(2R)-oxolan-2-yl]methoxy]acetyl]amino]pyrrole-2-carboxylate |
|---|---|
| PubChem CID | 164642629 |
| Molecular Formula | C15H22N2O5 |
| Molecular Weight | 310.35 g/mol |
| Exact Mass | 310.15 |
| IUPAC Name | ethyl 1-methyl-3-[[2-[[(2R)-oxolan-2-yl]methoxy]acetyl]amino]pyrrole-2-carboxylate |
| SMILES | CCOC(=O)c1c(NC(=O)COC[C@H]2CCCO2)ccn1C |
| InChI | InChI=1S/C15H22N2O5/c1-3-21-15(19)14-12(6-7-17(14)2)16-13(18)10-20-9-11-5-4-8-22-11/h6-7,11H,3-5,8-10H2,1-2H3,(H,16,18)/t11-/m1/s1 |
| InChIKey | DJCSPWUMOCSCLR-LLVKDONJSA-N |
| XLogP | 1.34 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.35 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |