C10H8FNOS — CID 164643807
[2-fluoro-4-(1,2-thiazol-3-yl)phenyl]methanol (PubChem CID 164643807) has the molecular formula C10H8FNOS and a molecular weight of 209.24 g/mol. Its IUPAC name is [2-fluoro-4-(1,2-thiazol-3-yl)phenyl]methanol.
| Compound Name | [2-fluoro-4-(1,2-thiazol-3-yl)phenyl]methanol |
|---|---|
| PubChem CID | 164643807 |
| Molecular Formula | C10H8FNOS |
| Molecular Weight | 209.24 g/mol |
| Exact Mass | 209.03 |
| IUPAC Name | [2-fluoro-4-(1,2-thiazol-3-yl)phenyl]methanol |
| SMILES | OCc1ccc(-c2ccsn2)cc1F |
| InChI | InChI=1S/C10H8FNOS/c11-9-5-7(1-2-8(9)6-13)10-3-4-14-12-10/h1-5,13H,6H2 |
| InChIKey | HCLBWUPHGVCVFL-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.24 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |