C11H16N2O — CID 164644029
2,2-dimethyl-3-(3-methylidenepiperidin-1-yl)-3-oxopropanenitrile (PubChem CID 164644029) has the molecular formula C11H16N2O and a molecular weight of 192.26 g/mol. Its IUPAC name is 2,2-dimethyl-3-(3-methylidenepiperidin-1-yl)-3-oxopropanenitrile.
| Compound Name | 2,2-dimethyl-3-(3-methylidenepiperidin-1-yl)-3-oxopropanenitrile |
|---|---|
| PubChem CID | 164644029 |
| Molecular Formula | C11H16N2O |
| Molecular Weight | 192.26 g/mol |
| Exact Mass | 192.13 |
| IUPAC Name | 2,2-dimethyl-3-(3-methylidenepiperidin-1-yl)-3-oxopropanenitrile |
| SMILES | C=C1CCCN(C(=O)C(C)(C)C#N)C1 |
| InChI | InChI=1S/C11H16N2O/c1-9-5-4-6-13(7-9)10(14)11(2,3)8-12/h1,4-7H2,2-3H3 |
| InChIKey | MKSCCPGZKUCWAJ-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 44.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.26 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|