C10H5BrClNOS — CID 164645649
(2-bromo-5-chlorophenyl)-(1,2-thiazol-4-yl)methanone (PubChem CID 164645649) has the molecular formula C10H5BrClNOS and a molecular weight of 302.58 g/mol. Its IUPAC name is (2-bromo-5-chlorophenyl)-(1,2-thiazol-4-yl)methanone.
| Compound Name | (2-bromo-5-chlorophenyl)-(1,2-thiazol-4-yl)methanone |
|---|---|
| PubChem CID | 164645649 |
| Molecular Formula | C10H5BrClNOS |
| Molecular Weight | 302.58 g/mol |
| Exact Mass | 300.90 |
| IUPAC Name | (2-bromo-5-chlorophenyl)-(1,2-thiazol-4-yl)methanone |
| SMILES | O=C(c1cnsc1)c1cc(Cl)ccc1Br |
| InChI | InChI=1S/C10H5BrClNOS/c11-9-2-1-7(12)3-8(9)10(14)6-4-13-15-5-6/h1-5H |
| InChIKey | VSXZXALGQVXTMK-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.58 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |